C12H20FNO3 — CID 156538377
tert-butyl (3S,4S)-4-ethenoxy-3-fluoropiperidine-1-carboxylate (PubChem CID 156538377) has the molecular formula C12H20FNO3 and a molecular weight of 245.29 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-ethenoxy-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-ethenoxy-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 156538377 |
| Molecular Formula | C12H20FNO3 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | tert-butyl (3S,4S)-4-ethenoxy-3-fluoropiperidine-1-carboxylate |
| SMILES | C=CO[C@H]1CCN(C(=O)OC(C)(C)C)C[C@@H]1F |
| InChI | InChI=1S/C12H20FNO3/c1-5-16-10-6-7-14(8-9(10)13)11(15)17-12(2,3)4/h5,9-10H,1,6-8H2,2-4H3/t9-,10-/m0/s1 |
| InChIKey | HPPFVMVDSYANQL-UWVGGRQHSA-N |
| XLogP | 2.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|