C11H18FNO3 — CID 97289468
tert-butyl (3S,4R)-3-fluoro-4-formylpiperidine-1-carboxylate (PubChem CID 97289468) has the molecular formula C11H18FNO3 and a molecular weight of 231.27 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-fluoro-4-formylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-fluoro-4-formylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 97289468 |
| Molecular Formula | C11H18FNO3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | tert-butyl (3S,4R)-3-fluoro-4-formylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C=O)[C@H](F)C1 |
| InChI | InChI=1S/C11H18FNO3/c1-11(2,3)16-10(15)13-5-4-8(7-14)9(12)6-13/h7-9H,4-6H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | ISILDNBHAGUQFT-RKDXNWHRSA-N |
| XLogP | 1.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|