C13H23NO5 — CID 86657808
tert-butyl (3S,4R)-4-formyl-3-(methoxymethoxy)piperidine-1-carboxylate (PubChem CID 86657808) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is tert-butyl (3S,4R)-4-formyl-3-(methoxymethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-4-formyl-3-(methoxymethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86657808 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | tert-butyl (3S,4R)-4-formyl-3-(methoxymethoxy)piperidine-1-carboxylate |
| SMILES | COCO[C@@H]1CN(C(=O)OC(C)(C)C)CC[C@H]1C=O |
| InChI | InChI=1S/C13H23NO5/c1-13(2,3)19-12(16)14-6-5-10(8-15)11(7-14)18-9-17-4/h8,10-11H,5-7,9H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | MRORSKKSFKGLQN-WDEREUQCSA-N |
| XLogP | 1.43 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|