C11H18NO4- — CID 35549272
2-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]acetate (PubChem CID 35549272) has the molecular formula C11H18NO4- and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]acetate.
| Compound Name | 2-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 35549272 |
| Molecular Formula | C11H18NO4- |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 2-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](CC(=O)[O-])C1 |
| InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(15)12-5-4-8(7-12)6-9(13)14/h8H,4-7H2,1-3H3,(H,13,14)/p-1/t8-/m0/s1 |
| InChIKey | SKEXQIJIXQSFRX-QMMMGPOBSA-M |
| XLogP | 0.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |