C12H20N2O4 — CID 172987938
tert-butyl 3-[(3E)-3-hydroxyimino-2-oxopropyl]pyrrolidine-1-carboxylate (PubChem CID 172987938) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is tert-butyl 3-[(3E)-3-hydroxyimino-2-oxopropyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3E)-3-hydroxyimino-2-oxopropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 172987938 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | tert-butyl 3-[(3E)-3-hydroxyimino-2-oxopropyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC(=O)/C=N/O)C1 |
| InChI | InChI=1S/C12H20N2O4/c1-12(2,3)18-11(16)14-5-4-9(8-14)6-10(15)7-13-17/h7,9,17H,4-6,8H2,1-3H3/b13-7+ |
| InChIKey | ZZUZZAYVOBIZCB-NTUHNPAUSA-N |
| XLogP | 1.66 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|