C14H29NO5 — CID 144976953
tert-butyl 3-(methoxymethyl)pyrrolidine-1-carboxylate;ethane;formic acid (PubChem CID 144976953) has the molecular formula C14H29NO5 and a molecular weight of 291.39 g/mol. Its IUPAC name is tert-butyl 3-(methoxymethyl)pyrrolidine-1-carboxylate;ethane;formic acid.
| Compound Name | tert-butyl 3-(methoxymethyl)pyrrolidine-1-carboxylate;ethane;formic acid |
|---|---|
| PubChem CID | 144976953 |
| Molecular Formula | C14H29NO5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | tert-butyl 3-(methoxymethyl)pyrrolidine-1-carboxylate;ethane;formic acid |
| SMILES | CC.COCC1CCN(C(=O)OC(C)(C)C)C1.O=CO |
| InChI | InChI=1S/C11H21NO3.C2H6.CH2O2/c1-11(2,3)15-10(13)12-6-5-9(7-12)8-14-4;1-2;2-1-3/h9H,5-8H2,1-4H3;1-2H3;1H,(H,2,3) |
| InChIKey | HXEJDUQDCAUPCZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|