C12H22N4O4 — CID 118329695
tert-butyl (3R,4R)-3-azido-4-(methoxymethoxy)piperidine-1-carboxylate (PubChem CID 118329695) has the molecular formula C12H22N4O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-azido-4-(methoxymethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-azido-4-(methoxymethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118329695 |
| Molecular Formula | C12H22N4O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | tert-butyl (3R,4R)-3-azido-4-(methoxymethoxy)piperidine-1-carboxylate |
| SMILES | COCO[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C12H22N4O4/c1-12(2,3)20-11(17)16-6-5-10(19-8-18-4)9(7-16)14-15-13/h9-10H,5-8H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | BMTNBTCVZKIDOW-NXEZZACHSA-N |
| XLogP | 2.30 |
| TPSA | 96.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|