C12H20N4O2 — CID 134363687
tert-butyl (3S,4S)-3-azido-4-cyclopropylpyrrolidine-1-carboxylate (PubChem CID 134363687) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-azido-4-cyclopropylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-azido-4-cyclopropylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134363687 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | tert-butyl (3S,4S)-3-azido-4-cyclopropylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C2CC2)[C@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C12H20N4O2/c1-12(2,3)18-11(17)16-6-9(8-4-5-8)10(7-16)14-15-13/h8-10H,4-7H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | WYKKAFNITYGUDH-NXEZZACHSA-N |
| XLogP | 2.94 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|