C15H30N4O3Si — CID 73081086
tert-butyl 3-azido-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 73081086) has the molecular formula C15H30N4O3Si and a molecular weight of 342.52 g/mol. Its IUPAC name is tert-butyl 3-azido-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-azido-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 73081086 |
| Molecular Formula | C15H30N4O3Si |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | tert-butyl 3-azido-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N=[N+]=[N-])C(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H30N4O3Si/c1-14(2,3)21-13(20)19-9-11(17-18-16)12(10-19)22-23(7,8)15(4,5)6/h11-12H,9-10H2,1-8H3 |
| InChIKey | PJFYRGDJAXLGAH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|