C15H32N2O3Si — CID 171756063
tert-butyl 3-amino-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 171756063) has the molecular formula C15H32N2O3Si and a molecular weight of 316.52 g/mol. Its IUPAC name is tert-butyl 3-amino-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-amino-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171756063 |
| Molecular Formula | C15H32N2O3Si |
| Molecular Weight | 316.52 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | tert-butyl 3-amino-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N)C(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H32N2O3Si/c1-14(2,3)19-13(18)17-9-11(16)12(10-17)20-21(7,8)15(4,5)6/h11-12H,9-10,16H2,1-8H3 |
| InChIKey | KCCWCXIGNSYWKJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|