C28H52N4O8 — CID 163359559
ditert-butyl 4-aminopyrrolidine-1,3-dicarboxylate (PubChem CID 163359559) has the molecular formula C28H52N4O8 and a molecular weight of 572.74 g/mol. Its IUPAC name is ditert-butyl 4-aminopyrrolidine-1,3-dicarboxylate.
| Compound Name | ditert-butyl 4-aminopyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 163359559 |
| Molecular Formula | C28H52N4O8 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.38 |
| IUPAC Name | ditert-butyl 4-aminopyrrolidine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CN(C(=O)OC(C)(C)C)CC1N.CC(C)(C)OC(=O)C1CN(C(=O)OC(C)(C)C)CC1N |
| InChI | InChI=1S/2C14H26N2O4/c2*1-13(2,3)19-11(17)9-7-16(8-10(9)15)12(18)20-14(4,5)6/h2*9-10H,7-8,15H2,1-6H3 |
| InChIKey | ORMBVVPRISNQOR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 163.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|