C21H45NO4Si2 — CID 135017355
tert-butyl (3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidine-1-carboxylate (PubChem CID 135017355) has the molecular formula C21H45NO4Si2 and a molecular weight of 431.77 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135017355 |
| Molecular Formula | C21H45NO4Si2 |
| Molecular Weight | 431.77 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | tert-butyl (3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H45NO4Si2/c1-19(2,3)24-18(23)22-14-16(25-27(10,11)20(4,5)6)17(15-22)26-28(12,13)21(7,8)9/h16-17H,14-15H2,1-13H3/t16-,17-/m0/s1 |
| InChIKey | VXQWWRAFOUWRQS-IRXDYDNUSA-N |
| XLogP | 6.02 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.77 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|