C19H39NO3Si2 — CID 102367454
1-[(3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 102367454) has the molecular formula C19H39NO3Si2 and a molecular weight of 385.70 g/mol. Its IUPAC name is 1-[(3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 102367454 |
| Molecular Formula | C19H39NO3Si2 |
| Molecular Weight | 385.70 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 1-[(3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H39NO3Si2/c1-12-17(21)20-13-15(22-24(8,9)18(2,3)4)16(14-20)23-25(10,11)19(5,6)7/h12,15-16H,1,13-14H2,2-11H3/t15-,16-/m0/s1 |
| InChIKey | JTDSZGSRWNKJNM-HOTGVXAUSA-N |
| XLogP | 4.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.70 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|