C18H40O4Si2 — CID 101111315
(1S,2S,4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexane-1,2-diol (PubChem CID 101111315) has the molecular formula C18H40O4Si2 and a molecular weight of 376.69 g/mol. Its IUPAC name is (1S,2S,4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexane-1,2-diol.
| Compound Name | (1S,2S,4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 101111315 |
| Molecular Formula | C18H40O4Si2 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | (1S,2S,4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexane-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](O)[C@@H](O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H40O4Si2/c1-17(2,3)23(7,8)21-15-11-13(19)14(20)12-16(15)22-24(9,10)18(4,5)6/h13-16,19-20H,11-12H2,1-10H3/t13-,14-,15-,16-/m0/s1 |
| InChIKey | XNZYUZZBJHEYPA-VGWMRTNUSA-N |
| XLogP | 4.28 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|