C21H48O4Si3 — CID 69230457
3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexan-1-ol (PubChem CID 69230457) has the molecular formula C21H48O4Si3 and a molecular weight of 448.87 g/mol. Its IUPAC name is 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexan-1-ol.
| Compound Name | 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexan-1-ol |
|---|---|
| PubChem CID | 69230457 |
| Molecular Formula | C21H48O4Si3 |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(O)CC(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C21H48O4Si3/c1-20(2,3)27(10,11)23-17-14-16(22)15-18(19(17)25-26(7,8)9)24-28(12,13)21(4,5)6/h16-19,22H,14-15H2,1-13H3 |
| InChIKey | LFTMOSPHRITGSV-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|