C24H50O5Si3 — CID 11409489
methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexylidene]acetate (PubChem CID 11409489) has the molecular formula C24H50O5Si3 and a molecular weight of 502.92 g/mol. Its IUPAC name is methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexylidene]acetate.
| Compound Name | methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexylidene]acetate |
|---|---|
| PubChem CID | 11409489 |
| Molecular Formula | C24H50O5Si3 |
| Molecular Weight | 502.92 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexylidene]acetate |
| SMILES | COC(=O)C=C1CC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C24H50O5Si3/c1-23(2,3)31(11,12)27-19-15-18(17-21(25)26-7)16-20(22(19)29-30(8,9)10)28-32(13,14)24(4,5)6/h17,19-20,22H,15-16H2,1-14H3/b18-17- |
| InChIKey | OGCZGQOUSBNQFP-ZCXUNETKSA-N |
| XLogP | 6.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.92 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|