C22H42O5Si2 — CID 54313452
methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-2-methylidenecyclohexylidene]acetate (PubChem CID 54313452) has the molecular formula C22H42O5Si2 and a molecular weight of 442.75 g/mol. Its IUPAC name is methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-2-methylidenecyclohexylidene]acetate.
| Compound Name | methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-2-methylidenecyclohexylidene]acetate |
|---|---|
| PubChem CID | 54313452 |
| Molecular Formula | C22H42O5Si2 |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-2-methylidenecyclohexylidene]acetate |
| SMILES | C=C1C(=CC(=O)OC)CC(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O5Si2/c1-15-16(14-18(23)25-8)13-17(26-28(9,10)21(2,3)4)19(24)20(15)27-29(11,12)22(5,6)7/h14,17,19-20,24H,1,13H2,2-12H3 |
| InChIKey | SMMPEWYRMNAWLR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|