C41H50O4Si2 — CID 54396942
2,6-bis[[tert-butyl(diphenyl)silyl]oxy]-4-(2-hydroxyethylidene)-3-methylidenecyclohexan-1-ol (PubChem CID 54396942) has the molecular formula C41H50O4Si2 and a molecular weight of 663.02 g/mol. Its IUPAC name is 2,6-bis[[tert-butyl(diphenyl)silyl]oxy]-4-(2-hydroxyethylidene)-3-methylidenecyclohexan-1-ol.
| Compound Name | 2,6-bis[[tert-butyl(diphenyl)silyl]oxy]-4-(2-hydroxyethylidene)-3-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 54396942 |
| Molecular Formula | C41H50O4Si2 |
| Molecular Weight | 663.02 g/mol |
| Exact Mass | 662.32 |
| IUPAC Name | 2,6-bis[[tert-butyl(diphenyl)silyl]oxy]-4-(2-hydroxyethylidene)-3-methylidenecyclohexan-1-ol |
| SMILES | C=C1C(=CCO)CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(O)C1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H50O4Si2/c1-31-32(28-29-42)30-37(44-46(40(2,3)4,33-20-12-8-13-21-33)34-22-14-9-15-23-34)38(43)39(31)45-47(41(5,6)7,35-24-16-10-17-25-35)36-26-18-11-19-27-36/h8-28,37-39,42-43H,1,29-30H2,2-7H3 |
| InChIKey | VKQVNXHHBOZYLU-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.02 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|