C53H59O3PSi2 — CID 86754892
tert-butyl-[(1S,3S,5Z)-3-[tert-butyl(diphenyl)silyl]oxy-5-(2-diphenylphosphorylethylidene)-4-methylidenecyclohexyl]oxy-diphenylsilane (PubChem CID 86754892) has the molecular formula C53H59O3PSi2 and a molecular weight of 831.20 g/mol. Its IUPAC name is tert-butyl-[(1S,3S,5Z)-3-[tert-butyl(diphenyl)silyl]oxy-5-(2-diphenylphosphorylethylidene)-4-methylidenecyclohexyl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(1S,3S,5Z)-3-[tert-butyl(diphenyl)silyl]oxy-5-(2-diphenylphosphorylethylidene)-4-methylidenecyclohexyl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 86754892 |
| Molecular Formula | C53H59O3PSi2 |
| Molecular Weight | 831.20 g/mol |
| Exact Mass | 830.37 |
| IUPAC Name | tert-butyl-[(1S,3S,5Z)-3-[tert-butyl(diphenyl)silyl]oxy-5-(2-diphenylphosphorylethylidene)-4-methylidenecyclohexyl]oxy-diphenylsilane |
| SMILES | C=C1/C(=C\CP(=O)(c2ccccc2)c2ccccc2)C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C53H59O3PSi2/c1-42-43(38-39-57(54,45-26-14-8-15-27-45)46-28-16-9-17-29-46)40-44(55-58(52(2,3)4,47-30-18-10-19-31-47)48-32-20-11-21-33-48)41-51(42)56-59(53(5,6)7,49-34-22-12-23-35-49)50-36-24-13-25-37-50/h8-38,44,51H,1,39-41H2,2-7H3/b43-38-/t44-,51-/m0/s1 |
| InChIKey | OTAWXJIJOFAKJE-GFMVVXEMSA-N |
| XLogP | 10.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.20 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|