C41H50O3Si2 — CID 56989707
2-[(3S,5S)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-methylidenecyclohexylidene]ethanol (PubChem CID 56989707) has the molecular formula C41H50O3Si2 and a molecular weight of 647.02 g/mol. Its IUPAC name is 2-[(3S,5S)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-methylidenecyclohexylidene]ethanol.
| Compound Name | 2-[(3S,5S)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-methylidenecyclohexylidene]ethanol |
|---|---|
| PubChem CID | 56989707 |
| Molecular Formula | C41H50O3Si2 |
| Molecular Weight | 647.02 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | 2-[(3S,5S)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-methylidenecyclohexylidene]ethanol |
| SMILES | C=C1C(=CCO)C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H50O3Si2/c1-32-33(28-29-42)30-34(43-45(40(2,3)4,35-20-12-8-13-21-35)36-22-14-9-15-23-36)31-39(32)44-46(41(5,6)7,37-24-16-10-17-25-37)38-26-18-11-19-27-38/h8-28,34,39,42H,1,29-31H2,2-7H3/t34-,39-/m0/s1 |
| InChIKey | BLRAUXJPQMOEQK-FPCLRPRSSA-N |
| XLogP | 7.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.02 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|