C40H66O5Si3 — CID 162404924
(2Z)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[tert-butyl(diphenyl)silyl]oxypropoxy]-2-methylidenecyclohexylidene]ethanol (PubChem CID 162404924) has the molecular formula C40H66O5Si3 and a molecular weight of 711.22 g/mol. Its IUPAC name is (2Z)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[tert-butyl(diphenyl)silyl]oxypropoxy]-2-methylidenecyclohexylidene]ethanol.
| Compound Name | (2Z)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[tert-butyl(diphenyl)silyl]oxypropoxy]-2-methylidenecyclohexylidene]ethanol |
|---|---|
| PubChem CID | 162404924 |
| Molecular Formula | C40H66O5Si3 |
| Molecular Weight | 711.22 g/mol |
| Exact Mass | 710.42 |
| IUPAC Name | (2Z)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[tert-butyl(diphenyl)silyl]oxypropoxy]-2-methylidenecyclohexylidene]ethanol |
| SMILES | C=C1/C(=C\CO)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H66O5Si3/c1-31-32(26-27-41)30-35(44-46(11,12)38(2,3)4)37(36(31)45-47(13,14)39(5,6)7)42-28-21-29-43-48(40(8,9)10,33-22-17-15-18-23-33)34-24-19-16-20-25-34/h15-20,22-26,35-37,41H,1,21,27-30H2,2-14H3/b32-26-/t35-,36-,37-/m1/s1 |
| InChIKey | DAWVDPORPIAUSI-TXZSVRNWSA-N |
| XLogP | 9.00 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.22 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|