C32H54O6Si2 — CID 173270962
methyl 2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidene-4-(3-phenylmethoxypropoxy)cyclohexylidene]acetate (PubChem CID 173270962) has the molecular formula C32H54O6Si2 and a molecular weight of 590.95 g/mol. Its IUPAC name is methyl 2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidene-4-(3-phenylmethoxypropoxy)cyclohexylidene]acetate.
| Compound Name | methyl 2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidene-4-(3-phenylmethoxypropoxy)cyclohexylidene]acetate |
|---|---|
| PubChem CID | 173270962 |
| Molecular Formula | C32H54O6Si2 |
| Molecular Weight | 590.95 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | methyl 2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidene-4-(3-phenylmethoxypropoxy)cyclohexylidene]acetate |
| SMILES | C=C1C(=CC(=O)OC)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCCCOCc2ccccc2)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H54O6Si2/c1-24-26(22-28(33)34-8)21-27(37-39(9,10)31(2,3)4)30(29(24)38-40(11,12)32(5,6)7)36-20-16-19-35-23-25-17-14-13-15-18-25/h13-15,17-18,22,27,29-30H,1,16,19-21,23H2,2-12H3/t27-,29-,30-/m1/s1 |
| InChIKey | LDGQQJJKXZWMGK-MJLPRTPSSA-N |
| XLogP | 7.82 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.95 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|