C24H38O3Si — CID 102400011
tert-butyl-dimethyl-[(2R,3R,6S)-4-methylidene-6-(2-phenylmethoxyethyl)-2-prop-2-enyloxan-3-yl]oxysilane (PubChem CID 102400011) has the molecular formula C24H38O3Si and a molecular weight of 402.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,3R,6S)-4-methylidene-6-(2-phenylmethoxyethyl)-2-prop-2-enyloxan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R,3R,6S)-4-methylidene-6-(2-phenylmethoxyethyl)-2-prop-2-enyloxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 102400011 |
| Molecular Formula | C24H38O3Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,3R,6S)-4-methylidene-6-(2-phenylmethoxyethyl)-2-prop-2-enyloxan-3-yl]oxysilane |
| SMILES | C=CC[C@H]1O[C@H](CCOCc2ccccc2)CC(=C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H38O3Si/c1-8-12-22-23(27-28(6,7)24(3,4)5)19(2)17-21(26-22)15-16-25-18-20-13-10-9-11-14-20/h8-11,13-14,21-23H,1-2,12,15-18H2,3-7H3/t21-,22-,23-/m1/s1 |
| InChIKey | ZTXVMSHWNXJAJQ-DNVJHFABSA-N |
| XLogP | 6.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|