C27H44O2Si — CID 11212530
tert-butyl-[(1R,2R,4S,5S)-5-ethenyl-5-methyl-2-(2-phenylmethoxyethyl)-4-prop-1-en-2-ylcyclohexyl]oxy-dimethylsilane (PubChem CID 11212530) has the molecular formula C27H44O2Si and a molecular weight of 428.73 g/mol. Its IUPAC name is tert-butyl-[(1R,2R,4S,5S)-5-ethenyl-5-methyl-2-(2-phenylmethoxyethyl)-4-prop-1-en-2-ylcyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2R,4S,5S)-5-ethenyl-5-methyl-2-(2-phenylmethoxyethyl)-4-prop-1-en-2-ylcyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11212530 |
| Molecular Formula | C27H44O2Si |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | tert-butyl-[(1R,2R,4S,5S)-5-ethenyl-5-methyl-2-(2-phenylmethoxyethyl)-4-prop-1-en-2-ylcyclohexyl]oxy-dimethylsilane |
| SMILES | C=C[C@]1(C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCOCc2ccccc2)C[C@H]1C(=C)C |
| InChI | InChI=1S/C27H44O2Si/c1-10-27(7)19-25(29-30(8,9)26(4,5)6)23(18-24(27)21(2)3)16-17-28-20-22-14-12-11-13-15-22/h10-15,23-25H,1-2,16-20H2,3-9H3/t23-,24-,25+,27+/m0/s1 |
| InChIKey | VZWUYYKDVGYEFB-AGBXIKQOSA-N |
| XLogP | 7.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|