C25H35NO4Si — CID 11236060
(4S)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-5-(phenylmethoxymethyl)pyrrolidin-2-one (PubChem CID 11236060) has the molecular formula C25H35NO4Si and a molecular weight of 441.64 g/mol. Its IUPAC name is (4S)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-5-(phenylmethoxymethyl)pyrrolidin-2-one.
| Compound Name | (4S)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-5-(phenylmethoxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 11236060 |
| Molecular Formula | C25H35NO4Si |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (4S)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-5-(phenylmethoxymethyl)pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)N(Cc2ccccc2)C1(O)COCc1ccccc1 |
| InChI | InChI=1S/C25H35NO4Si/c1-24(2,3)31(4,5)30-22-16-23(27)26(17-20-12-8-6-9-13-20)25(22,28)19-29-18-21-14-10-7-11-15-21/h6-15,22,28H,16-19H2,1-5H3/t22-,25?/m0/s1 |
| InChIKey | UIIOGLCIZPCCTB-XADRRFQNSA-N |
| XLogP | 4.71 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|