C22H33NO5Si — CID 176541833
methyl 3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(oxomethylidene)-2-(phenylmethoxymethyl)pyrrolidine-2-carboxylate (PubChem CID 176541833) has the molecular formula C22H33NO5Si and a molecular weight of 419.59 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(oxomethylidene)-2-(phenylmethoxymethyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(oxomethylidene)-2-(phenylmethoxymethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 176541833 |
| Molecular Formula | C22H33NO5Si |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(oxomethylidene)-2-(phenylmethoxymethyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1(COCc2ccccc2)NC(=C=O)C(C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H33NO5Si/c1-16-18(13-24)23-22(20(25)26-5,15-27-14-17-11-9-8-10-12-17)19(16)28-29(6,7)21(2,3)4/h8-12,16,19,23H,14-15H2,1-7H3 |
| InChIKey | MIRSOZVQOYMZKF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|