About methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate
methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate (PubChem CID 90208872) has the molecular formula C19H26O4Si
and a molecular weight of 346.50 g/mol. Its IUPAC name is methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 90208872 |
| Molecular Formula | C19H26O4Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)[C@]1(COCc2ccccc2)C=CC=C[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C19H26O4Si/c1-21-18(20)19(15-22-14-16-10-6-5-7-11-16)13-9-8-12-17(19)23-24(2,3)4/h5-13,17H,14-15H2,1-4H3/t17-,19+/m1/s1 |
| InChIKey | LNSANBBZQLJYJR-MJGOQNOKSA-N |
| XLogP | 3.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate (CID 90208872) is methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate is COC(=O)[C@]1(COCc2ccccc2)C=CC=C[C@H]1O[Si](C)(C)C.
What is the InChIKey of methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate?
The InChIKey is LNSANBBZQLJYJR-MJGOQNOKSA-N. The full InChI is InChI=1S/C19H26O4Si/c1-21-18(20)19(15-22-14-16-10-6-5-7-11-16)13-9-8-12-17(19)23-24(2,3)4/h5-13,17H,14-15H2,1-4H3/t17-,19+/m1/s1.
What are the key properties of methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate?
methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate has a molecular weight of 346.50 g/mol, XLogP of 3.71, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1S,6R)-1-(phenylmethoxymethyl)-6-trimethylsilyloxycyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 90208872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).