C30H48O5Si3 — CID 100999150
trimethyl-[(1S,2R,5S,6R)-2-phenylmethoxy-6-(phenylmethoxymethyl)-5,6-bis(trimethylsilyloxy)cyclohex-3-en-1-yl]oxysilane (PubChem CID 100999150) has the molecular formula C30H48O5Si3 and a molecular weight of 572.97 g/mol. Its IUPAC name is trimethyl-[(1S,2R,5S,6R)-2-phenylmethoxy-6-(phenylmethoxymethyl)-5,6-bis(trimethylsilyloxy)cyclohex-3-en-1-yl]oxysilane.
| Compound Name | trimethyl-[(1S,2R,5S,6R)-2-phenylmethoxy-6-(phenylmethoxymethyl)-5,6-bis(trimethylsilyloxy)cyclohex-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 100999150 |
| Molecular Formula | C30H48O5Si3 |
| Molecular Weight | 572.97 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | trimethyl-[(1S,2R,5S,6R)-2-phenylmethoxy-6-(phenylmethoxymethyl)-5,6-bis(trimethylsilyloxy)cyclohex-3-en-1-yl]oxysilane |
| SMILES | C[Si](C)(C)O[C@H]1C=C[C@@H](OCc2ccccc2)[C@H](O[Si](C)(C)C)[C@]1(COCc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C30H48O5Si3/c1-36(2,3)33-28-21-20-27(32-23-26-18-14-11-15-19-26)29(34-37(4,5)6)30(28,35-38(7,8)9)24-31-22-25-16-12-10-13-17-25/h10-21,27-29H,22-24H2,1-9H3/t27-,28+,29+,30-/m1/s1 |
| InChIKey | HEIABIUUVWBPNB-IBHPWDLASA-N |
| XLogP | 7.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.97 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|