C22H24O3 — CID 10544847
(2R,3S,6R)-6-ethenyl-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran (PubChem CID 10544847) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is (2R,3S,6R)-6-ethenyl-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3S,6R)-6-ethenyl-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 10544847 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (2R,3S,6R)-6-ethenyl-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran |
| SMILES | C=C[C@@H]1C=C[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C22H24O3/c1-2-20-13-14-21(24-16-19-11-7-4-8-12-19)22(25-20)17-23-15-18-9-5-3-6-10-18/h2-14,20-22H,1,15-17H2/t20-,21+,22-/m1/s1 |
| InChIKey | MVCFPJAXJIQANP-BHIFYINESA-N |
| XLogP | 4.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|