C27H27ClO4 — CID 53253826
(2R,3S,6S)-6-[(3-chlorophenyl)methoxy]-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran (PubChem CID 53253826) has the molecular formula C27H27ClO4 and a molecular weight of 450.96 g/mol. Its IUPAC name is (2R,3S,6S)-6-[(3-chlorophenyl)methoxy]-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3S,6S)-6-[(3-chlorophenyl)methoxy]-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 53253826 |
| Molecular Formula | C27H27ClO4 |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (2R,3S,6S)-6-[(3-chlorophenyl)methoxy]-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran |
| SMILES | Clc1cccc(CO[C@@H]2C=C[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O2)c1 |
| InChI | InChI=1S/C27H27ClO4/c28-24-13-7-12-23(16-24)19-31-27-15-14-25(30-18-22-10-5-2-6-11-22)26(32-27)20-29-17-21-8-3-1-4-9-21/h1-16,25-27H,17-20H2/t25-,26+,27-/m0/s1 |
| InChIKey | GLFFYBZMUWZJFF-VJGNERBWSA-N |
| XLogP | 5.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|