C29H29NO3 — CID 102132002
2-methyl-1-[(2R,3S,6R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-6-yl]indole (PubChem CID 102132002) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-methyl-1-[(2R,3S,6R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-6-yl]indole.
| Compound Name | 2-methyl-1-[(2R,3S,6R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-6-yl]indole |
|---|---|
| PubChem CID | 102132002 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2-methyl-1-[(2R,3S,6R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-6-yl]indole |
| SMILES | Cc1cc2ccccc2n1[C@H]1C=C[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C29H29NO3/c1-22-18-25-14-8-9-15-26(25)30(22)29-17-16-27(32-20-24-12-6-3-7-13-24)28(33-29)21-31-19-23-10-4-2-5-11-23/h2-18,27-29H,19-21H2,1H3/t27-,28+,29+/m0/s1 |
| InChIKey | CCAIPMBBMCIMHH-ZGIBFIJWSA-N |
| XLogP | 6.21 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|