C26H34O4 — CID 53255077
(2R,3S,6S)-6-hexoxy-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran (PubChem CID 53255077) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (2R,3S,6S)-6-hexoxy-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3S,6S)-6-hexoxy-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 53255077 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (2R,3S,6S)-6-hexoxy-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran |
| SMILES | CCCCCCO[C@@H]1C=C[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C26H34O4/c1-2-3-4-11-18-28-26-17-16-24(29-20-23-14-9-6-10-15-23)25(30-26)21-27-19-22-12-7-5-8-13-22/h5-10,12-17,24-26H,2-4,11,18-21H2,1H3/t24-,25+,26-/m0/s1 |
| InChIKey | QXYVNHBQJDOXCV-NXCFDTQHSA-N |
| XLogP | 5.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|