C22H26O4 — CID 11681901
(S)-[(2S,3R,6S)-6-ethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-3-yl]-phenylmethanol (PubChem CID 11681901) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (S)-[(2S,3R,6S)-6-ethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-3-yl]-phenylmethanol.
| Compound Name | (S)-[(2S,3R,6S)-6-ethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-3-yl]-phenylmethanol |
|---|---|
| PubChem CID | 11681901 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (S)-[(2S,3R,6S)-6-ethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-3-yl]-phenylmethanol |
| SMILES | CCO[C@@H]1C=C[C@H]([C@H](O)c2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C22H26O4/c1-2-25-21-14-13-19(22(23)18-11-7-4-8-12-18)20(26-21)16-24-15-17-9-5-3-6-10-17/h3-14,19-23H,2,15-16H2,1H3/t19-,20+,21-,22+/m0/s1 |
| InChIKey | WOQHDSZRLCSVFV-LNRXMEIDSA-N |
| XLogP | 3.87 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|