C25H34O9 — CID 101357896
(2R,3S,6R)-2-(phenylmethoxymethyl)-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]-3,6-dihydro-2H-pyran-3-ol (PubChem CID 101357896) has the molecular formula C25H34O9 and a molecular weight of 478.54 g/mol. Its IUPAC name is (2R,3S,6R)-2-(phenylmethoxymethyl)-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3S,6R)-2-(phenylmethoxymethyl)-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 101357896 |
| Molecular Formula | C25H34O9 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | (2R,3S,6R)-2-(phenylmethoxymethyl)-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CO[C@H]1C=C[C@H](O)[C@@H](COCc3ccccc3)O1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C25H34O9/c1-24(2)31-20-18(30-23-22(21(20)32-24)33-25(3,4)34-23)14-28-19-11-10-16(26)17(29-19)13-27-12-15-8-6-5-7-9-15/h5-11,16-23,26H,12-14H2,1-4H3/t16-,17+,18+,19+,20-,21-,22+,23+/m0/s1 |
| InChIKey | RTZBVHGBQPBZSO-KSEREMFGSA-N |
| XLogP | 2.26 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|