C32H40O10 — CID 11124755
(2R,3S,6S)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-[[(1S,2R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-4-one (PubChem CID 11124755) has the molecular formula C32H40O10 and a molecular weight of 584.66 g/mol. Its IUPAC name is (2R,3S,6S)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-[[(1S,2R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-4-one.
| Compound Name | (2R,3S,6S)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-[[(1S,2R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-4-one |
|---|---|
| PubChem CID | 11124755 |
| Molecular Formula | C32H40O10 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | (2R,3S,6S)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-[[(1S,2R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]oxan-4-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1OC(C)(C)OC1O[C@@H]2CO[C@@H]1CC(=O)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C32H40O10/c1-31(2)39-27-24(38-30-29(28(27)40-31)41-32(3,4)42-30)19-35-25-15-22(33)26(36-17-21-13-9-6-10-14-21)23(37-25)18-34-16-20-11-7-5-8-12-20/h5-14,23-30H,15-19H2,1-4H3/t23-,24-,25+,26-,27+,28+,29-,30?/m1/s1 |
| InChIKey | XPMRTBOPYNCXDD-FMSZDIHSSA-N |
| XLogP | 3.89 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |