C30H40O4 — CID 53255080
(2R,3R,6S)-6-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran (PubChem CID 53255080) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is (2R,3R,6S)-6-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3R,6S)-6-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 53255080 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | (2R,3R,6S)-6-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1O[C@@H]1C=C[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C30H40O4/c1-22(2)26-15-14-23(3)18-28(26)33-30-17-16-27(32-20-25-12-8-5-9-13-25)29(34-30)21-31-19-24-10-6-4-7-11-24/h4-13,16-17,22-23,26-30H,14-15,18-21H2,1-3H3/t23-,26+,27+,28-,29+,30-/m0/s1 |
| InChIKey | JEKOMMNKAUATCB-NLFRDLPRSA-N |
| XLogP | 6.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|