C44H54O6 — CID 102257251
(3R,4S,5R,6R)-2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 102257251) has the molecular formula C44H54O6 and a molecular weight of 678.91 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (3R,4S,5R,6R)-2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 102257251 |
| Molecular Formula | C44H54O6 |
| Molecular Weight | 678.91 g/mol |
| Exact Mass | 678.39 |
| IUPAC Name | (3R,4S,5R,6R)-2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C44H54O6/c1-32(2)38-25-24-33(3)26-39(38)49-44-43(48-30-37-22-14-7-15-23-37)42(47-29-36-20-12-6-13-21-36)41(46-28-35-18-10-5-11-19-35)40(50-44)31-45-27-34-16-8-4-9-17-34/h4-23,32-33,38-44H,24-31H2,1-3H3/t33-,38+,39-,40+,41+,42-,43+,44?/m0/s1 |
| InChIKey | DXRHYGQPOBZBGC-SWBOGYOISA-N |
| XLogP | 9.16 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.91 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |