C38H48O5 — CID 101445116
(2S,4R,5S,6R)-3-methylidene-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 101445116) has the molecular formula C38H48O5 and a molecular weight of 584.80 g/mol. Its IUPAC name is (2S,4R,5S,6R)-3-methylidene-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,4R,5S,6R)-3-methylidene-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 101445116 |
| Molecular Formula | C38H48O5 |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | (2S,4R,5S,6R)-3-methylidene-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | C=C1[C@@H](O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H48O5/c1-27(2)33-21-20-28(3)22-34(33)42-38-29(4)36(40-24-31-16-10-6-11-17-31)37(41-25-32-18-12-7-13-19-32)35(43-38)26-39-23-30-14-8-5-9-15-30/h5-19,27-28,33-38H,4,20-26H2,1-3H3/t28-,33+,34-,35-,36-,37-,38+/m1/s1 |
| InChIKey | STHAXBAEMNAOOE-UNSRZHCDSA-N |
| XLogP | 8.13 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|