C21H24O4 — CID 154734225
2-methoxy-3-methylidene-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolane (PubChem CID 154734225) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-methoxy-3-methylidene-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolane.
| Compound Name | 2-methoxy-3-methylidene-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolane |
|---|---|
| PubChem CID | 154734225 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-methoxy-3-methylidene-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolane |
| SMILES | C=C1C(OC)OC(COCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C21H24O4/c1-16-20(24-14-18-11-7-4-8-12-18)19(25-21(16)22-2)15-23-13-17-9-5-3-6-10-17/h3-12,19-21H,1,13-15H2,2H3 |
| InChIKey | UTXHTKVHDZPAPN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|