C32H38O7 — CID 102479657
(2S,4R,5R,6R)-2-(2,2-dimethoxyethoxy)-3-methylidene-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 102479657) has the molecular formula C32H38O7 and a molecular weight of 534.65 g/mol. Its IUPAC name is (2S,4R,5R,6R)-2-(2,2-dimethoxyethoxy)-3-methylidene-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,4R,5R,6R)-2-(2,2-dimethoxyethoxy)-3-methylidene-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 102479657 |
| Molecular Formula | C32H38O7 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | (2S,4R,5R,6R)-2-(2,2-dimethoxyethoxy)-3-methylidene-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | C=C1[C@@H](OCC(OC)OC)O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H38O7/c1-24-30(36-20-26-15-9-5-10-16-26)31(37-21-27-17-11-6-12-18-27)28(22-35-19-25-13-7-4-8-14-25)39-32(24)38-23-29(33-2)34-3/h4-18,28-32H,1,19-23H2,2-3H3/t28-,30-,31+,32+/m1/s1 |
| InChIKey | UXZQSDIVZLDLAS-BCSWWHSASA-N |
| XLogP | 5.29 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|