C31H32O5 — CID 102479656
(2R,3R,4R,6S)-5-methylidene-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-ynoxyoxane (PubChem CID 102479656) has the molecular formula C31H32O5 and a molecular weight of 484.59 g/mol. Its IUPAC name is (2R,3R,4R,6S)-5-methylidene-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-ynoxyoxane.
| Compound Name | (2R,3R,4R,6S)-5-methylidene-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-ynoxyoxane |
|---|---|
| PubChem CID | 102479656 |
| Molecular Formula | C31H32O5 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (2R,3R,4R,6S)-5-methylidene-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-ynoxyoxane |
| SMILES | C#CCO[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1=C |
| InChI | InChI=1S/C31H32O5/c1-3-19-33-31-24(2)29(34-21-26-15-9-5-10-16-26)30(35-22-27-17-11-6-12-18-27)28(36-31)23-32-20-25-13-7-4-8-14-25/h1,4-18,28-31H,2,19-23H2/t28-,29-,30+,31+/m1/s1 |
| InChIKey | DIOCIVJZRIJZSN-VKONIRKNSA-N |
| XLogP | 5.30 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|