C23H38O8 — CID 102018264
(2R,3S,4S,5R,6R)-2-(2,2-dimethoxyethoxy)-4,5-dimethoxy-6-(2-methylpropoxymethyl)-3-phenylmethoxyoxane (PubChem CID 102018264) has the molecular formula C23H38O8 and a molecular weight of 442.55 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(2,2-dimethoxyethoxy)-4,5-dimethoxy-6-(2-methylpropoxymethyl)-3-phenylmethoxyoxane.
| Compound Name | (2R,3S,4S,5R,6R)-2-(2,2-dimethoxyethoxy)-4,5-dimethoxy-6-(2-methylpropoxymethyl)-3-phenylmethoxyoxane |
|---|---|
| PubChem CID | 102018264 |
| Molecular Formula | C23H38O8 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(2,2-dimethoxyethoxy)-4,5-dimethoxy-6-(2-methylpropoxymethyl)-3-phenylmethoxyoxane |
| SMILES | COC(CO[C@@H]1O[C@H](COCC(C)C)[C@@H](OC)[C@H](OC)[C@@H]1OCc1ccccc1)OC |
| InChI | InChI=1S/C23H38O8/c1-16(2)12-28-14-18-20(26-5)21(27-6)22(29-13-17-10-8-7-9-11-17)23(31-18)30-15-19(24-3)25-4/h7-11,16,18-23H,12-15H2,1-6H3/t18-,20-,21+,22+,23-/m1/s1 |
| InChIKey | DAIJHGGHKGOKKH-LFDQFFAPSA-N |
| XLogP | 2.63 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|