C27H28O3 — CID 146166198
(2R,3S,6S)-4-methylidene-6-phenyl-3-phenylmethoxy-2-(phenylmethoxymethyl)oxane (PubChem CID 146166198) has the molecular formula C27H28O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is (2R,3S,6S)-4-methylidene-6-phenyl-3-phenylmethoxy-2-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3S,6S)-4-methylidene-6-phenyl-3-phenylmethoxy-2-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 146166198 |
| Molecular Formula | C27H28O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (2R,3S,6S)-4-methylidene-6-phenyl-3-phenylmethoxy-2-(phenylmethoxymethyl)oxane |
| SMILES | C=C1C[C@@H](c2ccccc2)O[C@H](COCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H28O3/c1-21-17-25(24-15-9-4-10-16-24)30-26(20-28-18-22-11-5-2-6-12-22)27(21)29-19-23-13-7-3-8-14-23/h2-16,25-27H,1,17-20H2/t25-,26+,27-/m0/s1 |
| InChIKey | GBASVUOCAOMVNT-VJGNERBWSA-N |
| XLogP | 5.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|