C33H35NO4 — CID 171557955
(2S,3R,4R,5R)-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-amine (PubChem CID 171557955) has the molecular formula C33H35NO4 and a molecular weight of 509.65 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-amine.
| Compound Name | (2S,3R,4R,5R)-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-amine |
|---|---|
| PubChem CID | 171557955 |
| Molecular Formula | C33H35NO4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | (2S,3R,4R,5R)-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-amine |
| SMILES | N[C@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C(COCc2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C33H35NO4/c34-30-31(28-19-11-4-12-20-28)38-29(24-35-21-25-13-5-1-6-14-25)32(36-22-26-15-7-2-8-16-26)33(30)37-23-27-17-9-3-10-18-27/h1-20,29-33H,21-24,34H2/t29?,30-,31+,32+,33-/m1/s1 |
| InChIKey | MWRAMXUPTDDORP-QMTKCSJISA-N |
| XLogP | 5.84 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |