C28H33NO4 — CID 118563862
(2R,4S,6R)-2-methyl-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-amine (PubChem CID 118563862) has the molecular formula C28H33NO4 and a molecular weight of 447.57 g/mol. Its IUPAC name is (2R,4S,6R)-2-methyl-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-amine.
| Compound Name | (2R,4S,6R)-2-methyl-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-amine |
|---|---|
| PubChem CID | 118563862 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (2R,4S,6R)-2-methyl-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-amine |
| SMILES | C[C@H]1O[C@H](COCc2ccccc2)C(OCc2ccccc2)[C@@H](N)C1OCc1ccccc1 |
| InChI | InChI=1S/C28H33NO4/c1-21-27(31-18-23-13-7-3-8-14-23)26(29)28(32-19-24-15-9-4-10-16-24)25(33-21)20-30-17-22-11-5-2-6-12-22/h2-16,21,25-28H,17-20,29H2,1H3/t21-,25-,26+,27?,28?/m1/s1 |
| InChIKey | XNMBQLFDAYAILR-XJPDBZHPSA-N |
| XLogP | 4.49 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |