C24H31NO4 — CID 158265028
2-[(2R,3S,4R,5S,6R)-3,4-dimethyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]acetamide (PubChem CID 158265028) has the molecular formula C24H31NO4 and a molecular weight of 397.51 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5S,6R)-3,4-dimethyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]acetamide.
| Compound Name | 2-[(2R,3S,4R,5S,6R)-3,4-dimethyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]acetamide |
|---|---|
| PubChem CID | 158265028 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 2-[(2R,3S,4R,5S,6R)-3,4-dimethyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]acetamide |
| SMILES | C[C@@H]1[C@H](C)[C@@H](CC(N)=O)O[C@H](COCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C24H31NO4/c1-17-18(2)24(28-15-20-11-7-4-8-12-20)22(29-21(17)13-23(25)26)16-27-14-19-9-5-3-6-10-19/h3-12,17-18,21-22,24H,13-16H2,1-2H3,(H2,25,26)/t17-,18+,21+,22+,24-/m0/s1 |
| InChIKey | GIIHQVXHAVXLOU-YKIDYYDRSA-N |
| XLogP | 3.70 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |