C28H31ClO4 — CID 90859316
(2R,4S,5S)-2-chloro-3-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 90859316) has the molecular formula C28H31ClO4 and a molecular weight of 467.01 g/mol. Its IUPAC name is (2R,4S,5S)-2-chloro-3-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,4S,5S)-2-chloro-3-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 90859316 |
| Molecular Formula | C28H31ClO4 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | (2R,4S,5S)-2-chloro-3-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CC1[C@@H](Cl)OC(COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H31ClO4/c1-21-26(31-18-23-13-7-3-8-14-23)27(32-19-24-15-9-4-10-16-24)25(33-28(21)29)20-30-17-22-11-5-2-6-12-22/h2-16,21,25-28H,17-20H2,1H3/t21?,25?,26-,27+,28-/m0/s1 |
| InChIKey | DFOWUHHNUXKDNM-IXELTYQVSA-N |
| XLogP | 5.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|