C17H26O2 — CID 57170894
2-[(1S,2R,4R)-4-methyl-2-phenylmethoxycyclohexyl]propan-1-ol (PubChem CID 57170894) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-[(1S,2R,4R)-4-methyl-2-phenylmethoxycyclohexyl]propan-1-ol.
| Compound Name | 2-[(1S,2R,4R)-4-methyl-2-phenylmethoxycyclohexyl]propan-1-ol |
|---|---|
| PubChem CID | 57170894 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-[(1S,2R,4R)-4-methyl-2-phenylmethoxycyclohexyl]propan-1-ol |
| SMILES | CC(CO)[C@@H]1CC[C@@H](C)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C17H26O2/c1-13-8-9-16(14(2)11-18)17(10-13)19-12-15-6-4-3-5-7-15/h3-7,13-14,16-18H,8-12H2,1-2H3/t13-,14?,16+,17-/m1/s1 |
| InChIKey | JRZDGASQXUEZIR-XRIDFMPVSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |