C17H24O2 — CID 171358532
(2S)-2-methyl-2-[(1R,2R,4R)-4-methyl-2-phenylmethoxycyclohexyl]oxirane (PubChem CID 171358532) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (2S)-2-methyl-2-[(1R,2R,4R)-4-methyl-2-phenylmethoxycyclohexyl]oxirane.
| Compound Name | (2S)-2-methyl-2-[(1R,2R,4R)-4-methyl-2-phenylmethoxycyclohexyl]oxirane |
|---|---|
| PubChem CID | 171358532 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (2S)-2-methyl-2-[(1R,2R,4R)-4-methyl-2-phenylmethoxycyclohexyl]oxirane |
| SMILES | C[C@@H]1CC[C@@H]([C@@]2(C)CO2)[C@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C17H24O2/c1-13-8-9-15(17(2)12-19-17)16(10-13)18-11-14-6-4-3-5-7-14/h3-7,13,15-16H,8-12H2,1-2H3/t13-,15-,16-,17-/m1/s1 |
| InChIKey | BPXGRXLIZOXXNQ-MWQQHZPXSA-N |
| XLogP | 3.80 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|