C11H14O2 — CID 163224715
[(1R,2R)-2-methoxycyclopropyl]oxymethylbenzene (PubChem CID 163224715) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is [(1R,2R)-2-methoxycyclopropyl]oxymethylbenzene.
| Compound Name | [(1R,2R)-2-methoxycyclopropyl]oxymethylbenzene |
|---|---|
| PubChem CID | 163224715 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | [(1R,2R)-2-methoxycyclopropyl]oxymethylbenzene |
| SMILES | CO[C@@H]1C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C11H14O2/c1-12-10-7-11(10)13-8-9-5-3-2-4-6-9/h2-6,10-11H,7-8H2,1H3/t10-,11-/m1/s1 |
| InChIKey | SWXWGJIEQBHQJK-GHMZBOCLSA-N |
| XLogP | 1.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |